C27H36NO3+ — CID 3057552
(8-methyl-8-pentyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2,2-diphenylacetate (PubChem CID 3057552) has the molecular formula C27H36NO3+ and a molecular weight of 422.59 g/mol. Its IUPAC name is (8-methyl-8-pentyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2,2-diphenylacetate.
| Compound Name | (8-methyl-8-pentyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 3057552 |
| Molecular Formula | C27H36NO3+ |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (8-methyl-8-pentyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-hydroxy-2,2-diphenylacetate |
| SMILES | CCCCC[N+]1(C)C2CCC1CC(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C27H36NO3/c1-3-4-11-18-28(2)23-16-17-24(28)20-25(19-23)31-26(29)27(30,21-12-7-5-8-13-21)22-14-9-6-10-15-22/h5-10,12-15,23-25,30H,3-4,11,16-20H2,1-2H3/q+1 |
| InChIKey | OICHXRWDTLAKPT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|