C25H31BrFNO3 — CID 155558054
[8-(3-fluoropropyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide (PubChem CID 155558054) has the molecular formula C25H31BrFNO3 and a molecular weight of 492.43 g/mol. Its IUPAC name is [8-(3-fluoropropyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide.
| Compound Name | [8-(3-fluoropropyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
|---|---|
| PubChem CID | 155558054 |
| Molecular Formula | C25H31BrFNO3 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [8-(3-fluoropropyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate bromide |
| SMILES | C[N+]1(CCCF)C2CCC1CC(OC(=O)C(O)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C25H31FNO3.BrH/c1-27(16-8-15-26)21-13-14-22(27)18-23(17-21)30-24(28)25(29,19-9-4-2-5-10-19)20-11-6-3-7-12-20;/h2-7,9-12,21-23,29H,8,13-18H2,1H3;1H/q+1;/p-1 |
| InChIKey | WVVOJXLJTBFDCE-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|