C28H36NO3+ — CID 163983067
(9-methyl-9-pentyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2,2-diphenylpropanoate (PubChem CID 163983067) has the molecular formula C28H36NO3+ and a molecular weight of 434.60 g/mol. Its IUPAC name is (9-methyl-9-pentyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2,2-diphenylpropanoate.
| Compound Name | (9-methyl-9-pentyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2,2-diphenylpropanoate |
|---|---|
| PubChem CID | 163983067 |
| Molecular Formula | C28H36NO3+ |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (9-methyl-9-pentyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2,2-diphenylpropanoate |
| SMILES | CCCCC[N+]1(C)C2CC(OC(=O)C(C)(c3ccccc3)c3ccccc3)CC1C1OC12 |
| InChI | InChI=1S/C28H36NO3/c1-4-5-12-17-29(3)23-18-22(19-24(29)26-25(23)32-26)31-27(30)28(2,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h6-11,13-16,22-26H,4-5,12,17-19H2,1-3H3/q+1 |
| InChIKey | TTXKZXWJNNPQKD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|