C20H36NO3+ — CID 71301121
[(1S,2S,4R,5S)-9-butyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-propylpentanoate (PubChem CID 71301121) has the molecular formula C20H36NO3+ and a molecular weight of 338.51 g/mol. Its IUPAC name is [(1S,2S,4R,5S)-9-butyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-propylpentanoate.
| Compound Name | [(1S,2S,4R,5S)-9-butyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-propylpentanoate |
|---|---|
| PubChem CID | 71301121 |
| Molecular Formula | C20H36NO3+ |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | [(1S,2S,4R,5S)-9-butyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-propylpentanoate |
| SMILES | CCCC[N+]1(C)[C@H]2CC(OC(=O)C(CCC)CCC)C[C@H]1[C@H]1O[C@H]12 |
| InChI | InChI=1S/C20H36NO3/c1-5-8-11-21(4)16-12-15(13-17(21)19-18(16)24-19)23-20(22)14(9-6-2)10-7-3/h14-19H,5-13H2,1-4H3/q+1/t15?,16-,17-,18-,19+,21?/m0/s1 |
| InChIKey | FKYJRGUIXFOVSG-PZLHVWBCSA-N |
| XLogP | 3.67 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|