C18H32NO3+ — CID 71301123
[(1S,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-propylpentanoate (PubChem CID 71301123) has the molecular formula C18H32NO3+ and a molecular weight of 310.46 g/mol. Its IUPAC name is [(1S,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-propylpentanoate.
| Compound Name | [(1S,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-propylpentanoate |
|---|---|
| PubChem CID | 71301123 |
| Molecular Formula | C18H32NO3+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | [(1S,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OC1C[C@H]2[C@@H]3O[C@@H]3[C@H](C1)[N+]2(C)CC |
| InChI | InChI=1S/C18H32NO3/c1-5-8-12(9-6-2)18(20)21-13-10-14-16-17(22-16)15(11-13)19(14,4)7-3/h12-17H,5-11H2,1-4H3/q+1/t13?,14-,15-,16-,17+,19?/m0/s1 |
| InChIKey | QYDIGQSGMITUQP-RDGXSEFMSA-N |
| XLogP | 2.89 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|