C19H22NO3S2+ — CID 56925926
[(1R,2S,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-dithiophen-2-ylacetate (PubChem CID 56925926) has the molecular formula C19H22NO3S2+ and a molecular weight of 376.52 g/mol. Its IUPAC name is [(1R,2S,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-dithiophen-2-ylacetate.
| Compound Name | [(1R,2S,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 56925926 |
| Molecular Formula | C19H22NO3S2+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [(1R,2S,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-dithiophen-2-ylacetate |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)C(c3cccs3)c3cccs3)C[C@H]1[C@@H]1O[C@H]12 |
| InChI | InChI=1S/C19H22NO3S2/c1-20(2)12-9-11(10-13(20)18-17(12)23-18)22-19(21)16(14-5-3-7-24-14)15-6-4-8-25-15/h3-8,11-13,16-18H,9-10H2,1-2H3/q+1/t11?,12-,13+,17-,18-/m0/s1 |
| InChIKey | USICRRDYZUGMHJ-PZSFTQSMSA-N |
| XLogP | 3.24 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|