C15H20BrNO4S — CID 72712473
[(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-thiophen-2-ylacetate bromide (PubChem CID 72712473) has the molecular formula C15H20BrNO4S and a molecular weight of 390.30 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-thiophen-2-ylacetate bromide.
| Compound Name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-thiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 72712473 |
| Molecular Formula | C15H20BrNO4S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-thiophen-2-ylacetate bromide |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)C(O)c3cccs3)C[C@H]1[C@@H]1O[C@@H]12.[Br-] |
| InChI | InChI=1S/C15H20NO4S.BrH/c1-16(2)9-6-8(7-10(16)14-13(9)20-14)19-15(18)12(17)11-4-3-5-21-11;/h3-5,8-10,12-14,17H,6-7H2,1-2H3;1H/q+1;/p-1/t8?,9-,10+,12?,13-,14+; |
| InChIKey | BCPQEEOHCQIZRI-KIMQZJFISA-M |
| XLogP | -1.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|