C20H26NO3S2+ — CID 123505305
(9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 3-methylsulfanyl-2-thiophen-2-ylhexa-3,5-dienoate (PubChem CID 123505305) has the molecular formula C20H26NO3S2+ and a molecular weight of 392.57 g/mol. Its IUPAC name is (9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 3-methylsulfanyl-2-thiophen-2-ylhexa-3,5-dienoate.
| Compound Name | (9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 3-methylsulfanyl-2-thiophen-2-ylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 123505305 |
| Molecular Formula | C20H26NO3S2+ |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 3-methylsulfanyl-2-thiophen-2-ylhexa-3,5-dienoate |
| SMILES | C=CC=C(SC)C(C(=O)OC1CC2C3OC3C(C1)[N+]2(C)C)c1cccs1 |
| InChI | InChI=1S/C20H26NO3S2/c1-5-7-15(25-4)17(16-8-6-9-26-16)20(22)23-12-10-13-18-19(24-18)14(11-12)21(13,2)3/h5-9,12-14,17-19H,1,10-11H2,2-4H3/q+1 |
| InChIKey | XOYNQCHYJVAXAN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|