C21H28NO8+ — CID 23725734
[(1S,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate;oxalic acid (PubChem CID 23725734) has the molecular formula C21H28NO8+ and a molecular weight of 422.45 g/mol. Its IUPAC name is [(1S,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate;oxalic acid.
| Compound Name | [(1S,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate;oxalic acid |
|---|---|
| PubChem CID | 23725734 |
| Molecular Formula | C21H28NO8+ |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [(1S,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate;oxalic acid |
| SMILES | CC[N+]1(C)[C@H]2CC(OC(=O)C(CO)c3ccccc3)C[C@H]1[C@H]1O[C@H]12.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H26NO4.C2H2O4/c1-3-20(2)15-9-13(10-16(20)18-17(15)24-18)23-19(22)14(11-21)12-7-5-4-6-8-12;3-1(4)2(5)6/h4-8,13-18,21H,3,9-11H2,1-2H3;(H,3,4)(H,5,6)/q+1;/t13?,14?,15-,16-,17-,18+,20?;/m0./s1 |
| InChIKey | VVZFGAYFQSNNJN-UDNGBRBASA-N |
| XLogP | 0.61 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|