C19H28NO4+ — CID 124770882
[(1R,3S,5S,6R,8S)-8-ethyl-6-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2R)-3-hydroxy-2-phenylpropanoate (PubChem CID 124770882) has the molecular formula C19H28NO4+ and a molecular weight of 334.44 g/mol. Its IUPAC name is [(1R,3S,5S,6R,8S)-8-ethyl-6-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2R)-3-hydroxy-2-phenylpropanoate.
| Compound Name | [(1R,3S,5S,6R,8S)-8-ethyl-6-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2R)-3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 124770882 |
| Molecular Formula | C19H28NO4+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [(1R,3S,5S,6R,8S)-8-ethyl-6-hydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2R)-3-hydroxy-2-phenylpropanoate |
| SMILES | CC[N@@+]1(C)[C@H]2C[C@H](OC(=O)[C@@H](CO)c3ccccc3)C[C@H]1[C@H](O)C2 |
| InChI | InChI=1S/C19H28NO4/c1-3-20(2)14-9-15(11-17(20)18(22)10-14)24-19(23)16(12-21)13-7-5-4-6-8-13/h4-8,14-18,21-22H,3,9-12H2,1-2H3/q+1/t14-,15-,16-,17-,18+,20-/m0/s1 |
| InChIKey | XCNYCAGTMKJDDN-IHEFFSNCSA-N |
| XLogP | 1.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|