C20H26NO4+ — CID 124839393
[(1S,3S,5S,6S,8R)-6-hydroxy-8-methyl-8-prop-2-ynyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate (PubChem CID 124839393) has the molecular formula C20H26NO4+ and a molecular weight of 344.43 g/mol. Its IUPAC name is [(1S,3S,5S,6S,8R)-6-hydroxy-8-methyl-8-prop-2-ynyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate.
| Compound Name | [(1S,3S,5S,6S,8R)-6-hydroxy-8-methyl-8-prop-2-ynyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 124839393 |
| Molecular Formula | C20H26NO4+ |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | [(1S,3S,5S,6S,8R)-6-hydroxy-8-methyl-8-prop-2-ynyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate |
| SMILES | C#CC[N@+]1(C)[C@@H]2C[C@H](OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@@H](O)C2 |
| InChI | InChI=1S/C20H26NO4/c1-3-9-21(2)15-10-16(12-18(21)19(23)11-15)25-20(24)17(13-22)14-7-5-4-6-8-14/h1,4-8,15-19,22-23H,9-13H2,2H3/q+1/t15-,16+,17-,18+,19+,21-/m1/s1 |
| InChIKey | JQICIHDXPAIITB-FBGLYXIBSA-N |
| XLogP | 1.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|