C18H26NO4+ — CID 98497011
[(1R,3S,5S,6S)-6-hydroxy-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate (PubChem CID 98497011) has the molecular formula C18H26NO4+ and a molecular weight of 320.41 g/mol. Its IUPAC name is [(1R,3S,5S,6S)-6-hydroxy-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate.
| Compound Name | [(1R,3S,5S,6S)-6-hydroxy-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 98497011 |
| Molecular Formula | C18H26NO4+ |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | [(1R,3S,5S,6S)-6-hydroxy-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate |
| SMILES | C[N+]1(C)[C@H]2C[C@H](OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@@H](O)C2 |
| InChI | InChI=1S/C18H26NO4/c1-19(2)13-8-14(10-16(19)17(21)9-13)23-18(22)15(11-20)12-6-4-3-5-7-12/h3-7,13-17,20-21H,8-11H2,1-2H3/q+1/t13-,14-,15+,16-,17-/m0/s1 |
| InChIKey | IYSMYVOALXTCSU-KSWRQPAISA-N |
| XLogP | 1.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|