C20H30NO4+ — CID 159339162
(9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;methane (PubChem CID 159339162) has the molecular formula C20H30NO4+ and a molecular weight of 348.46 g/mol. Its IUPAC name is (9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;methane.
| Compound Name | (9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;methane |
|---|---|
| PubChem CID | 159339162 |
| Molecular Formula | C20H30NO4+ |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;methane |
| SMILES | C.CC[N+]1(C)C2CC(OC(=O)[C@H](CO)c3ccccc3)CC1C1OC12 |
| InChI | InChI=1S/C19H26NO4.CH4/c1-3-20(2)15-9-13(10-16(20)18-17(15)24-18)23-19(22)14(11-21)12-7-5-4-6-8-12;/h4-8,13-18,21H,3,9-11H2,1-2H3;1H4/q+1;/t13?,14-,15?,16?,17?,18?,20?;/m1./s1 |
| InChIKey | CNDUGZJHKWXGGX-GLQSYWNLSA-N |
| XLogP | 2.09 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|