C21H32BrNO5 — CID 169434217
[(1S,5R,6S,7S)-8-butyl-6,7-dihydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide (PubChem CID 169434217) has the molecular formula C21H32BrNO5 and a molecular weight of 458.39 g/mol. Its IUPAC name is [(1S,5R,6S,7S)-8-butyl-6,7-dihydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide.
| Compound Name | [(1S,5R,6S,7S)-8-butyl-6,7-dihydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide |
|---|---|
| PubChem CID | 169434217 |
| Molecular Formula | C21H32BrNO5 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [(1S,5R,6S,7S)-8-butyl-6,7-dihydroxy-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide |
| SMILES | CCCC[N+]1(C)[C@@H]2CC(OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@H](O)[C@H]2O.[Br-] |
| InChI | InChI=1S/C21H32NO5.BrH/c1-3-4-10-22(2)17-11-15(12-18(22)20(25)19(17)24)27-21(26)16(13-23)14-8-6-5-7-9-14;/h5-9,15-20,23-25H,3-4,10-13H2,1-2H3;1H/q+1;/p-1/t15?,16-,17-,18+,19+,20+,22?;/m1./s1 |
| InChIKey | CBEOFDVZGFCURH-YBMQUVCASA-M |
| XLogP | -1.81 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|