C25H40BrNO3 — CID 3057540
(8-heptyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 4-hydroxy-2-phenylbutanoate bromide (PubChem CID 3057540) has the molecular formula C25H40BrNO3 and a molecular weight of 482.50 g/mol. Its IUPAC name is (8-heptyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 4-hydroxy-2-phenylbutanoate bromide.
| Compound Name | (8-heptyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 4-hydroxy-2-phenylbutanoate bromide |
|---|---|
| PubChem CID | 3057540 |
| Molecular Formula | C25H40BrNO3 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (8-heptyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 4-hydroxy-2-phenylbutanoate bromide |
| SMILES | CCCCCCC[N+]1(C)C2CCC1CC(OC(=O)C(CCO)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C25H40NO3.BrH/c1-3-4-5-6-10-16-26(2)21-13-14-22(26)19-23(18-21)29-25(28)24(15-17-27)20-11-8-7-9-12-20;/h7-9,11-12,21-24,27H,3-6,10,13-19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XIQNZJHDYPNSTM-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|