C29H40NO3+ — CID 24847409
[8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate (PubChem CID 24847409) has the molecular formula C29H40NO3+ and a molecular weight of 450.64 g/mol. Its IUPAC name is [8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate.
| Compound Name | [8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 24847409 |
| Molecular Formula | C29H40NO3+ |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | [8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
| SMILES | CCCCCc1ccc(C[N+]2(C)C3CCC2CC(OC(=O)C(CO)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C29H40NO3/c1-3-4-6-9-22-12-14-23(15-13-22)20-30(2)25-16-17-26(30)19-27(18-25)33-29(32)28(21-31)24-10-7-5-8-11-24/h5,7-8,10-15,25-28,31H,3-4,6,9,16-21H2,1-2H3/q+1 |
| InChIKey | IAOQKBVUVOSNII-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|