C34H48BrNO2 — CID 71301075
[(1R,5S)-8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 2-cyclohexyl-2-phenylacetate bromide (PubChem CID 71301075) has the molecular formula C34H48BrNO2 and a molecular weight of 582.67 g/mol. Its IUPAC name is [(1R,5S)-8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 2-cyclohexyl-2-phenylacetate bromide.
| Compound Name | [(1R,5S)-8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 2-cyclohexyl-2-phenylacetate bromide |
|---|---|
| PubChem CID | 71301075 |
| Molecular Formula | C34H48BrNO2 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | [(1R,5S)-8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 2-cyclohexyl-2-phenylacetate bromide |
| SMILES | CCCCCc1ccc(C[N+]2(C)[C@@H]3CC[C@H]2CC(OC(=O)C(c2ccccc2)C2CCCCC2)C3)cc1.[Br-] |
| InChI | InChI=1S/C34H48NO2.BrH/c1-3-4-7-12-26-17-19-27(20-18-26)25-35(2)30-21-22-31(35)24-32(23-30)37-34(36)33(28-13-8-5-9-14-28)29-15-10-6-11-16-29;/h5,8-9,13-14,17-20,29-33H,3-4,6-7,10-12,15-16,21-25H2,1-2H3;1H/q+1;/p-1/t30-,31+,32?,33?,35?; |
| InChIKey | YXMFVCDZFWGTGD-LTFGNXGPSA-M |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|