C23H28BrNO2 — CID 50909186
[(1R,5R)-8-methyl-8-[(4-methylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate bromide (PubChem CID 50909186) has the molecular formula C23H28BrNO2 and a molecular weight of 430.39 g/mol. Its IUPAC name is [(1R,5R)-8-methyl-8-[(4-methylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate bromide.
| Compound Name | [(1R,5R)-8-methyl-8-[(4-methylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate bromide |
|---|---|
| PubChem CID | 50909186 |
| Molecular Formula | C23H28BrNO2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [(1R,5R)-8-methyl-8-[(4-methylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate bromide |
| SMILES | Cc1ccc(C[N+]2(C)[C@@H]3CC[C@@H]2CC(OC(=O)c2ccccc2)C3)cc1.[Br-] |
| InChI | InChI=1S/C23H28NO2.BrH/c1-17-8-10-18(11-9-17)16-24(2)20-12-13-21(24)15-22(14-20)26-23(25)19-6-4-3-5-7-19;/h3-11,20-22H,12-16H2,1-2H3;1H/q+1;/p-1/t20-,21-,22?,24?;/m1./s1 |
| InChIKey | PYWOSTLJEWWZDK-YVMDEPTQSA-M |
| XLogP | 1.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|