C29H40BrNO3 — CID 71301077
[(1R,5S)-8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate bromide (PubChem CID 71301077) has the molecular formula C29H40BrNO3 and a molecular weight of 530.55 g/mol. Its IUPAC name is [(1R,5S)-8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate bromide.
| Compound Name | [(1R,5S)-8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate bromide |
|---|---|
| PubChem CID | 71301077 |
| Molecular Formula | C29H40BrNO3 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | [(1R,5S)-8-methyl-8-[(4-pentylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate bromide |
| SMILES | CCCCCc1ccc(C[N+]2(C)[C@@H]3CC[C@H]2CC(OC(=O)C(CO)c2ccccc2)C3)cc1.[Br-] |
| InChI | InChI=1S/C29H40NO3.BrH/c1-3-4-6-9-22-12-14-23(15-13-22)20-30(2)25-16-17-26(30)19-27(18-25)33-29(32)28(21-31)24-10-7-5-8-11-24;/h5,7-8,10-15,25-28,31H,3-4,6,9,16-21H2,1-2H3;1H/q+1;/p-1/t25-,26+,27?,28?,30?; |
| InChIKey | LMZXFOYKSILQEG-ZQHYLJJJSA-M |
| XLogP | 2.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|