C27H36NO3+ — CID 24847395
[8-methyl-8-[(4-propan-2-ylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate (PubChem CID 24847395) has the molecular formula C27H36NO3+ and a molecular weight of 422.59 g/mol. Its IUPAC name is [8-methyl-8-[(4-propan-2-ylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate.
| Compound Name | [8-methyl-8-[(4-propan-2-ylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 24847395 |
| Molecular Formula | C27H36NO3+ |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | [8-methyl-8-[(4-propan-2-ylphenyl)methyl]-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
| SMILES | CC(C)c1ccc(C[N+]2(C)C3CCC2CC(OC(=O)C(CO)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C27H36NO3/c1-19(2)21-11-9-20(10-12-21)17-28(3)23-13-14-24(28)16-25(15-23)31-27(30)26(18-29)22-7-5-4-6-8-22/h4-12,19,23-26,29H,13-18H2,1-3H3/q+1 |
| InChIKey | PNPVYABJRYLWAO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|