C28H38NO3+ — CID 24847381
[(1S,5R)-8-[(4-butylphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate (PubChem CID 24847381) has the molecular formula C28H38NO3+ and a molecular weight of 436.62 g/mol. Its IUPAC name is [(1S,5R)-8-[(4-butylphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate.
| Compound Name | [(1S,5R)-8-[(4-butylphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 24847381 |
| Molecular Formula | C28H38NO3+ |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [(1S,5R)-8-[(4-butylphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
| SMILES | CCCCc1ccc(C[N+]2(C)[C@@H]3CC[C@H]2CC(OC(=O)C(CO)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C28H38NO3/c1-3-4-8-21-11-13-22(14-12-21)19-29(2)24-15-16-25(29)18-26(17-24)32-28(31)27(20-30)23-9-6-5-7-10-23/h5-7,9-14,24-27,30H,3-4,8,15-20H2,1-2H3/q+1/t24-,25+,26?,27?,29? |
| InChIKey | LFJIGFRDHZAGKW-HATVBMISSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|