C19H30BrNO2 — CID 88829532
8-[(4-butoxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol bromide (PubChem CID 88829532) has the molecular formula C19H30BrNO2 and a molecular weight of 384.36 g/mol. Its IUPAC name is 8-[(4-butoxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol bromide.
| Compound Name | 8-[(4-butoxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol bromide |
|---|---|
| PubChem CID | 88829532 |
| Molecular Formula | C19H30BrNO2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 8-[(4-butoxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-ol bromide |
| SMILES | CCCCOc1ccc(C[N+]2(C)C3CCC2CC(O)C3)cc1.[Br-] |
| InChI | InChI=1S/C19H30NO2.BrH/c1-3-4-11-22-19-9-5-15(6-10-19)14-20(2)16-7-8-17(20)13-18(21)12-16;/h5-6,9-10,16-18,21H,3-4,7-8,11-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | RSWHIXROCBFEDB-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|