C12H23NO3 — CID 107565799
(2,6-dimethyloxan-4-yl) (2R)-2-aminopentanoate (PubChem CID 107565799) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is (2,6-dimethyloxan-4-yl) (2R)-2-aminopentanoate.
| Compound Name | (2,6-dimethyloxan-4-yl) (2R)-2-aminopentanoate |
|---|---|
| PubChem CID | 107565799 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | (2,6-dimethyloxan-4-yl) (2R)-2-aminopentanoate |
| SMILES | CCC[C@@H](N)C(=O)OC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C12H23NO3/c1-4-5-11(13)12(14)16-10-6-8(2)15-9(3)7-10/h8-11H,4-7,13H2,1-3H3/t8?,9?,10?,11-/m1/s1 |
| InChIKey | OGHGUCGKVXSVNQ-AHELAYONSA-N |
| XLogP | 1.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |