C24H34NO2+ — CID 10435870
[(1R,5S)-8-methyl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate (PubChem CID 10435870) has the molecular formula C24H34NO2+ and a molecular weight of 368.54 g/mol. Its IUPAC name is [(1R,5S)-8-methyl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate.
| Compound Name | [(1R,5S)-8-methyl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 10435870 |
| Molecular Formula | C24H34NO2+ |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | [(1R,5S)-8-methyl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate |
| SMILES | CCC[N+]1(C)[C@@H]2CC[C@H]1CC(OC(=O)C1CCCC=C1c1ccccc1)C2 |
| InChI | InChI=1S/C24H34NO2/c1-3-15-25(2)19-13-14-20(25)17-21(16-19)27-24(26)23-12-8-7-11-22(23)18-9-5-4-6-10-18/h4-6,9-11,19-21,23H,3,7-8,12-17H2,1-2H3/q+1/t19-,20+,21?,23?,25? |
| InChIKey | BZIQSISSUQEFCL-LTABOZGPSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|