C21H32NO3+ — CID 139024535
[(1R,5S)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-methoxy-2-phenylpropanoate (PubChem CID 139024535) has the molecular formula C21H32NO3+ and a molecular weight of 346.49 g/mol. Its IUPAC name is [(1R,5S)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,5S)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 139024535 |
| Molecular Formula | C21H32NO3+ |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | [(1R,5S)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-methoxy-2-phenylpropanoate |
| SMILES | COCC(C(=O)OC1C[C@H]2CC[C@@H](C1)[N+]2(C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H32NO3/c1-15(2)22(3)17-10-11-18(22)13-19(12-17)25-21(23)20(14-24-4)16-8-6-5-7-9-16/h5-9,15,17-20H,10-14H2,1-4H3/q+1/t17-,18+,19?,20?,22? |
| InChIKey | UTWRCMWQUQBNTK-OZPODJOQSA-N |
| XLogP | 3.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|