C19H28NO3+ — CID 118220456
[(2S,7S)-7-methyl-7-propan-2-yl-7-azoniabicyclo[2.2.1]heptan-2-yl] 3-hydroxy-2-phenylpropanoate (PubChem CID 118220456) has the molecular formula C19H28NO3+ and a molecular weight of 318.44 g/mol. Its IUPAC name is [(2S,7S)-7-methyl-7-propan-2-yl-7-azoniabicyclo[2.2.1]heptan-2-yl] 3-hydroxy-2-phenylpropanoate.
| Compound Name | [(2S,7S)-7-methyl-7-propan-2-yl-7-azoniabicyclo[2.2.1]heptan-2-yl] 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 118220456 |
| Molecular Formula | C19H28NO3+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | [(2S,7S)-7-methyl-7-propan-2-yl-7-azoniabicyclo[2.2.1]heptan-2-yl] 3-hydroxy-2-phenylpropanoate |
| SMILES | CC(C)[N@@+]1(C)C2CCC1[C@@H](OC(=O)C(CO)c1ccccc1)C2 |
| InChI | InChI=1S/C19H28NO3/c1-13(2)20(3)15-9-10-17(20)18(11-15)23-19(22)16(12-21)14-7-5-4-6-8-14/h4-8,13,15-18,21H,9-12H2,1-3H3/q+1/t15?,16?,17?,18-,20-/m0/s1 |
| InChIKey | IXPWUSZZEJFGBI-MTXCBWQVSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|