C17H13Cl3O2 — CID 145368307
(2,3,4-trichlorophenyl) 2-phenylcyclobutane-1-carboxylate (PubChem CID 145368307) has the molecular formula C17H13Cl3O2 and a molecular weight of 355.65 g/mol. Its IUPAC name is (2,3,4-trichlorophenyl) 2-phenylcyclobutane-1-carboxylate.
| Compound Name | (2,3,4-trichlorophenyl) 2-phenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 145368307 |
| Molecular Formula | C17H13Cl3O2 |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | (2,3,4-trichlorophenyl) 2-phenylcyclobutane-1-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)c(Cl)c1Cl)C1CCC1c1ccccc1 |
| InChI | InChI=1S/C17H13Cl3O2/c18-13-8-9-14(16(20)15(13)19)22-17(21)12-7-6-11(12)10-4-2-1-3-5-10/h1-5,8-9,11-12H,6-7H2 |
| InChIKey | CCZUTSXAOWOTNV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|