C20H22O — CID 13397264
1-[(1R,2S,5R)-2,5-diphenylcyclohexyl]ethanone (PubChem CID 13397264) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-[(1R,2S,5R)-2,5-diphenylcyclohexyl]ethanone.
| Compound Name | 1-[(1R,2S,5R)-2,5-diphenylcyclohexyl]ethanone |
|---|---|
| PubChem CID | 13397264 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[(1R,2S,5R)-2,5-diphenylcyclohexyl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H22O/c1-15(21)20-14-18(16-8-4-2-5-9-16)12-13-19(20)17-10-6-3-7-11-17/h2-11,18-20H,12-14H2,1H3/t18-,19-,20+/m1/s1 |
| InChIKey | RHQURUARCRTSFM-AQNXPRMDSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |