C14H17NO2S — CID 143783303
(2-sulfanylidene-1-pyridinyl) (3E,5E)-2,2-dimethylhepta-3,5-dienoate (PubChem CID 143783303) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) (3E,5E)-2,2-dimethylhepta-3,5-dienoate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) (3E,5E)-2,2-dimethylhepta-3,5-dienoate |
|---|---|
| PubChem CID | 143783303 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) (3E,5E)-2,2-dimethylhepta-3,5-dienoate |
| SMILES | C/C=C/C=C/C(C)(C)C(=O)On1ccccc1=S |
| InChI | InChI=1S/C14H17NO2S/c1-4-5-7-10-14(2,3)13(16)17-15-11-8-6-9-12(15)18/h4-11H,1-3H3/b5-4+,10-7+ |
| InChIKey | PHSWGFIAHNGPHN-YIORLJKJSA-N |
| XLogP | 3.33 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|