C12H11N3O4S — CID 15476695
(2-sulfanylidene-1-pyridinyl) 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 15476695) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 15476695 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | Cc1cn(CC(=O)On2ccccc2=S)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H11N3O4S/c1-8-6-14(12(18)13-11(8)17)7-10(16)19-15-5-3-2-4-9(15)20/h2-6H,7H2,1H3,(H,13,17,18) |
| InChIKey | VRDJMGWVNIGORZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|