C18H22N2O5 — CID 166334199
3-(2-phenylethoxy)propyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 166334199) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-(2-phenylethoxy)propyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | 3-(2-phenylethoxy)propyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 166334199 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-(2-phenylethoxy)propyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | Cc1cn(CC(=O)OCCCOCCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22N2O5/c1-14-12-20(18(23)19-17(14)22)13-16(21)25-10-5-9-24-11-8-15-6-3-2-4-7-15/h2-4,6-7,12H,5,8-11,13H2,1H3,(H,19,22,23) |
| InChIKey | QKGBXISDRPAMDX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|