About 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid
2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid (PubChem CID 141105320) has the molecular formula C15H16N2O5
and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid |
| PubChem CID | 141105320 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CCOCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H16N2O5/c18-13(19)9-17-8-12(14(20)16-15(17)21)6-7-22-10-11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2,(H,18,19)(H,16,20,21) |
| InChIKey | NOYLPWVRJFKBFK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid?
The IUPAC name of 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid (CID 141105320) is 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid.
What is the SMILES notation for 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid?
The canonical SMILES for 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid is O=C(O)Cn1cc(CCOCc2ccccc2)c(=O)[nH]c1=O.
What is the InChIKey of 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid?
The InChIKey is NOYLPWVRJFKBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O5/c18-13(19)9-17-8-12(14(20)16-15(17)21)6-7-22-10-11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2,(H,18,19)(H,16,20,21).
What are the key properties of 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid?
2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid has a molecular weight of 304.30 g/mol, XLogP of 0.38, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid is sourced from PubChem (CID 141105320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).