C15H16N2O5 — CID 141105320
2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid (PubChem CID 141105320) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid.
| Compound Name | 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 141105320 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-[2,4-dioxo-5-(2-phenylmethoxyethyl)pyrimidin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CCOCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H16N2O5/c18-13(19)9-17-8-12(14(20)16-15(17)21)6-7-22-10-11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2,(H,18,19)(H,16,20,21) |
| InChIKey | NOYLPWVRJFKBFK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|