C15H19N3O3 — CID 72845534
2-[3-methyl-5-(3-phenylmethoxypropyl)-1,2,4-triazol-1-yl]acetic acid (PubChem CID 72845534) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[3-methyl-5-(3-phenylmethoxypropyl)-1,2,4-triazol-1-yl]acetic acid.
| Compound Name | 2-[3-methyl-5-(3-phenylmethoxypropyl)-1,2,4-triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 72845534 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[3-methyl-5-(3-phenylmethoxypropyl)-1,2,4-triazol-1-yl]acetic acid |
| SMILES | Cc1nc(CCCOCc2ccccc2)n(CC(=O)O)n1 |
| InChI | InChI=1S/C15H19N3O3/c1-12-16-14(18(17-12)10-15(19)20)8-5-9-21-11-13-6-3-2-4-7-13/h2-4,6-7H,5,8-11H2,1H3,(H,19,20) |
| InChIKey | DVAHIYONLBUSMQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|