C21H29N3O2 — CID 66737741
1-[4-(4-benzylpiperidin-1-yl)butyl]-5-methylpyrimidine-2,4-dione (PubChem CID 66737741) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperidin-1-yl)butyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[4-(4-benzylpiperidin-1-yl)butyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66737741 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-[4-(4-benzylpiperidin-1-yl)butyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CCCCN2CCC(Cc3ccccc3)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H29N3O2/c1-17-16-24(21(26)22-20(17)25)12-6-5-11-23-13-9-19(10-14-23)15-18-7-3-2-4-8-18/h2-4,7-8,16,19H,5-6,9-15H2,1H3,(H,22,25,26) |
| InChIKey | ZHBCPJPJEFFWFU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|