C24H32N4O4 — CID 66737819
1-[4-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione (PubChem CID 66737819) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-[4-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[4-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66737819 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1-[4-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CCCCN2CCN(C(Cc3ccccc3)C3=COCO3)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H32N4O4/c1-19-16-28(24(30)25-23(19)29)10-6-5-9-26-11-13-27(14-12-26)21(22-17-31-18-32-22)15-20-7-3-2-4-8-20/h2-4,7-8,16-17,21H,5-6,9-15,18H2,1H3,(H,25,29,30) |
| InChIKey | RVYTWVIKVGDZGE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|