C19H24ClFN4O2 — CID 67373956
1-[4-[4-(4-chloro-2-fluorophenyl)piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione (PubChem CID 67373956) has the molecular formula C19H24ClFN4O2 and a molecular weight of 394.88 g/mol. Its IUPAC name is 1-[4-[4-(4-chloro-2-fluorophenyl)piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[4-[4-(4-chloro-2-fluorophenyl)piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67373956 |
| Molecular Formula | C19H24ClFN4O2 |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-[4-[4-(4-chloro-2-fluorophenyl)piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CCCCN2CCN(c3ccc(Cl)cc3F)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H24ClFN4O2/c1-14-13-25(19(27)22-18(14)26)7-3-2-6-23-8-10-24(11-9-23)17-5-4-15(20)12-16(17)21/h4-5,12-13H,2-3,6-11H2,1H3,(H,22,26,27) |
| InChIKey | MXTPWQZPHFAPSE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|