C20H28N4O2 — CID 67373850
5-methyl-1-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]pyrimidine-2,4-dione (PubChem CID 67373850) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 5-methyl-1-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67373850 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 5-methyl-1-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(N2CCN(CCCCn3cc(C)c(=O)[nH]c3=O)CC2)cc1 |
| InChI | InChI=1S/C20H28N4O2/c1-16-5-7-18(8-6-16)23-13-11-22(12-14-23)9-3-4-10-24-15-17(2)19(25)21-20(24)26/h5-8,15H,3-4,9-14H2,1-2H3,(H,21,25,26) |
| InChIKey | DNHDKWQXSVKHKR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|