C13H22N2O4 — CID 144939598
tert-butyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate;ethane (PubChem CID 144939598) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is tert-butyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate;ethane.
| Compound Name | tert-butyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate;ethane |
|---|---|
| PubChem CID | 144939598 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | tert-butyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate;ethane |
| SMILES | CC.Cc1cn(CC(=O)OC(C)(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16N2O4.C2H6/c1-7-5-13(10(16)12-9(7)15)6-8(14)17-11(2,3)4;1-2/h5H,6H2,1-4H3,(H,12,15,16);1-2H3 |
| InChIKey | MOZSINRGKBMJHJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |