C19H30N4O7 — CID 140514369
tert-butyl 2-[2-[(2-ethoxy-2-oxoethyl)-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylamino]acetate (PubChem CID 140514369) has the molecular formula C19H30N4O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is tert-butyl 2-[2-[(2-ethoxy-2-oxoethyl)-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylamino]acetate.
| Compound Name | tert-butyl 2-[2-[(2-ethoxy-2-oxoethyl)-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylamino]acetate |
|---|---|
| PubChem CID | 140514369 |
| Molecular Formula | C19H30N4O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | tert-butyl 2-[2-[(2-ethoxy-2-oxoethyl)-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylamino]acetate |
| SMILES | CCOC(=O)CN(CCNCC(=O)OC(C)(C)C)C(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H30N4O7/c1-6-29-16(26)12-22(8-7-20-9-15(25)30-19(3,4)5)14(24)11-23-10-13(2)17(27)21-18(23)28/h10,20H,6-9,11-12H2,1-5H3,(H,21,27,28) |
| InChIKey | IVXVMBJLVGCRLX-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|