C12H18BN4O6 — CID 70943586
CID 70943586 (PubChem CID 70943586) has the molecular formula C12H18BN4O6 and a molecular weight of 325.11 g/mol.
| Compound Name | CID 70943586 |
|---|---|
| PubChem CID | 70943586 |
| Molecular Formula | C12H18BN4O6 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | — |
| SMILES | Cc1cn(CC(=O)N(CC[B]OCN)CC(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H18BN4O6/c1-8-4-17(12(22)15-11(8)21)5-9(18)16(6-10(19)20)3-2-13-23-7-14/h4H,2-3,5-7,14H2,1H3,(H,19,20)(H,15,21,22) |
| InChIKey | UZFYEPRRMHODQM-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|