C17H20N4O5 — CID 10713526
methyl 2-[(2-aminophenyl)methyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]acetate (PubChem CID 10713526) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 2-[(2-aminophenyl)methyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]acetate.
| Compound Name | methyl 2-[(2-aminophenyl)methyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 10713526 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | methyl 2-[(2-aminophenyl)methyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1ccccc1N)C(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H20N4O5/c1-11-7-21(17(25)19-16(11)24)9-14(22)20(10-15(23)26-2)8-12-5-3-4-6-13(12)18/h3-7H,8-10,18H2,1-2H3,(H,19,24,25) |
| InChIKey | HRBKJFUCAPCJQW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|