C18H22N4O5 — CID 10738158
methyl (2S)-2-[(2-aminophenyl)methyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate (PubChem CID 10738158) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is methyl (2S)-2-[(2-aminophenyl)methyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[(2-aminophenyl)methyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 10738158 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | methyl (2S)-2-[(2-aminophenyl)methyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)N(Cc1ccccc1N)C(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22N4O5/c1-11-8-21(18(26)20-16(11)24)10-15(23)22(12(2)17(25)27-3)9-13-6-4-5-7-14(13)19/h4-8,12H,9-10,19H2,1-3H3,(H,20,24,26)/t12-/m0/s1 |
| InChIKey | NFMGQOHIIAAZBN-LBPRGKRZSA-N |
| XLogP | 0.02 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|