2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid

C24H29NO3 — CID 10499941

IUPAC2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid
SMILESCCN(CC)C(=O)C(CCCC=C(c1ccccc1)c1ccccc1)C(=O)O
InChIInChI=1S/C24H29NO3/c1-3-25(4-2)23(26)22(24(27)28)18-12-11-17-21(19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-17,22H,3-4,11-12,18H2,1-2H3,(H,27,28)
InChIKeyHHIZTJRJTCLVMZ-UHFFFAOYSA-N
MW379.50 g/mol
LogP4.86
Rot. Bonds10

About 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid

2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid (PubChem CID 10499941) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid.

Molecular Properties

Compound Name2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid
PubChem CID10499941
Molecular FormulaC24H29NO3
Molecular Weight379.50 g/mol
Exact Mass379.21
IUPAC Name2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid
SMILESCCN(CC)C(=O)C(CCCC=C(c1ccccc1)c1ccccc1)C(=O)O
InChIInChI=1S/C24H29NO3/c1-3-25(4-2)23(26)22(24(27)28)18-12-11-17-21(19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-17,22H,3-4,11-12,18H2,1-2H3,(H,27,28)
InChIKeyHHIZTJRJTCLVMZ-UHFFFAOYSA-N
XLogP4.86
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500379.50
LogP ≤ 54.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid?
The IUPAC name of 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid (CID 10499941) is 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid.
What is the SMILES notation for 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid?
The canonical SMILES for 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid is CCN(CC)C(=O)C(CCCC=C(c1ccccc1)c1ccccc1)C(=O)O.
What is the InChIKey of 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid?
The InChIKey is HHIZTJRJTCLVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO3/c1-3-25(4-2)23(26)22(24(27)28)18-12-11-17-21(19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-17,22H,3-4,11-12,18H2,1-2H3,(H,27,28).
What are the key properties of 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid?
2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid has a molecular weight of 379.50 g/mol, XLogP of 4.86, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid is sourced from PubChem (CID 10499941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).