C24H29NO3 — CID 10499941
2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid (PubChem CID 10499941) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid.
| Compound Name | 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid |
|---|---|
| PubChem CID | 10499941 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-(diethylcarbamoyl)-7,7-diphenylhept-6-enoic acid |
| SMILES | CCN(CC)C(=O)C(CCCC=C(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H29NO3/c1-3-25(4-2)23(26)22(24(27)28)18-12-11-17-21(19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-17,22H,3-4,11-12,18H2,1-2H3,(H,27,28) |
| InChIKey | HHIZTJRJTCLVMZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|