C19H21NO3 — CID 10244952
(2R)-2-(4,4-diphenylbut-3-enylamino)-3-hydroxypropanoic acid (PubChem CID 10244952) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2R)-2-(4,4-diphenylbut-3-enylamino)-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-(4,4-diphenylbut-3-enylamino)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 10244952 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (2R)-2-(4,4-diphenylbut-3-enylamino)-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](CO)NCCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO3/c21-14-18(19(22)23)20-13-7-12-17(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-12,18,20-21H,7,13-14H2,(H,22,23)/t18-/m1/s1 |
| InChIKey | CYPLQXQHWNTKSB-GOSISDBHSA-N |
| XLogP | 2.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|