C16H19NO3 — CID 174733531
1,1'-biphenyl;3-hydroxy-2-(methylamino)propanoic acid (PubChem CID 174733531) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1,1'-biphenyl;3-hydroxy-2-(methylamino)propanoic acid.
| Compound Name | 1,1'-biphenyl;3-hydroxy-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 174733531 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1,1'-biphenyl;3-hydroxy-2-(methylamino)propanoic acid |
| SMILES | CNC(CO)C(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H9NO3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5-3(2-6)4(7)8/h1-10H;3,5-6H,2H2,1H3,(H,7,8) |
| InChIKey | DHVOPTLYCFXKTM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |