5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid

C20H22O2 — CID 57178273

IUPAC5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid
SMILESCC(C)c1ccc(C(=CCCC(=O)O)c2ccccc2)cc1
InChIInChI=1S/C20H22O2/c1-15(2)16-11-13-18(14-12-16)19(9-6-10-20(21)22)17-7-4-3-5-8-17/h3-5,7-9,11-15H,6,10H2,1-2H3,(H,21,22)
InChIKeyPQYODGULNCWNSD-UHFFFAOYSA-N
MW294.39 g/mol
LogP5.11
Rot. Bonds6

About 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid

5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid (PubChem CID 57178273) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid.

Molecular Properties

Compound Name5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid
PubChem CID57178273
Molecular FormulaC20H22O2
Molecular Weight294.39 g/mol
Exact Mass294.16
IUPAC Name5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid
SMILESCC(C)c1ccc(C(=CCCC(=O)O)c2ccccc2)cc1
InChIInChI=1S/C20H22O2/c1-15(2)16-11-13-18(14-12-16)19(9-6-10-20(21)22)17-7-4-3-5-8-17/h3-5,7-9,11-15H,6,10H2,1-2H3,(H,21,22)
InChIKeyPQYODGULNCWNSD-UHFFFAOYSA-N
XLogP5.11
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500294.39
LogP ≤ 55.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(E)-5-(4-propan-2-ylphenyl)-5-thiophen-3-ylpent-4-enoic acid
CID 70276452
potassium 1-phenyl-3-(4-propan-2-ylphenyl)propane-1,3-dione
CID 56948149
3-hydroxy-3-phenyl-1-(4-propan-2-ylphenyl)prop-2-en-1-one
CID 3102941
1,4-bis(4-propan-2-ylphenyl)butane-1,4-dione
CID 166515280
sodium 2-amino-5,5-bis(4-propan-2-ylphenyl)pent-4-enoate
CID 23710784
2-hydroxy-1-phenyl-2-(4-propan-2-ylphenyl)ethanone
CID 23513084
[(E)-4-(4-chlorophenyl)-4-phenylbut-3-enyl] acetate
CID 102243525
cumene;octanoic acid
CID 174815768
(E)-5-(4-bromophenyl)-6-methylhept-4-enoic acid
CID 82308149
3-[methyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]amino]propanoic acid
CID 82136248
copper 4-propan-2-ylbenzoic acid
CID 54605006
4-propan-2-ylbenzoic acid;hydrochloride
CID 70157848

Frequently Asked Questions

What is the IUPAC name of 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid?
The IUPAC name of 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid (CID 57178273) is 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid.
What is the SMILES notation for 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid?
The canonical SMILES for 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid is CC(C)c1ccc(C(=CCCC(=O)O)c2ccccc2)cc1.
What is the InChIKey of 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid?
The InChIKey is PQYODGULNCWNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O2/c1-15(2)16-11-13-18(14-12-16)19(9-6-10-20(21)22)17-7-4-3-5-8-17/h3-5,7-9,11-15H,6,10H2,1-2H3,(H,21,22).
What are the key properties of 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid?
5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid has a molecular weight of 294.39 g/mol, XLogP of 5.11, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-5-(4-propan-2-ylphenyl)pent-4-enoic acid is sourced from PubChem (CID 57178273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).