C18H20O2S — CID 70276452
(E)-5-(4-propan-2-ylphenyl)-5-thiophen-3-ylpent-4-enoic acid (PubChem CID 70276452) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is (E)-5-(4-propan-2-ylphenyl)-5-thiophen-3-ylpent-4-enoic acid.
| Compound Name | (E)-5-(4-propan-2-ylphenyl)-5-thiophen-3-ylpent-4-enoic acid |
|---|---|
| PubChem CID | 70276452 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (E)-5-(4-propan-2-ylphenyl)-5-thiophen-3-ylpent-4-enoic acid |
| SMILES | CC(C)c1ccc(/C(=C\CCC(=O)O)c2ccsc2)cc1 |
| InChI | InChI=1S/C18H20O2S/c1-13(2)14-6-8-15(9-7-14)17(4-3-5-18(19)20)16-10-11-21-12-16/h4,6-13H,3,5H2,1-2H3,(H,19,20)/b17-4+ |
| InChIKey | QHNUFCSKBVIERJ-HAVNEIBRSA-N |
| XLogP | 5.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |