C21H24ClNOS2 — CID 110181817
4,4-di(thiophen-3-yl)but-3-enyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride (PubChem CID 110181817) has the molecular formula C21H24ClNOS2 and a molecular weight of 406.02 g/mol. Its IUPAC name is 4,4-di(thiophen-3-yl)but-3-enyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride.
| Compound Name | 4,4-di(thiophen-3-yl)but-3-enyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 110181817 |
| Molecular Formula | C21H24ClNOS2 |
| Molecular Weight | 406.02 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 4,4-di(thiophen-3-yl)but-3-enyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
| SMILES | CC([NH2+]CCC=C(c1ccsc1)c1ccsc1)C(O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H23NOS2.ClH/c1-16(21(23)17-6-3-2-4-7-17)22-11-5-8-20(18-9-12-24-14-18)19-10-13-25-15-19;/h2-4,6-10,12-16,21-23H,5,11H2,1H3;1H |
| InChIKey | VTQHRQLYCJZFCE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.02 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|