C22H29NOS — CID 110181698
2-[[(Z)-3-cyclohexyl-3-thiophen-3-ylprop-2-enyl]amino]-1-phenylpropan-1-ol (PubChem CID 110181698) has the molecular formula C22H29NOS and a molecular weight of 355.55 g/mol. Its IUPAC name is 2-[[(Z)-3-cyclohexyl-3-thiophen-3-ylprop-2-enyl]amino]-1-phenylpropan-1-ol.
| Compound Name | 2-[[(Z)-3-cyclohexyl-3-thiophen-3-ylprop-2-enyl]amino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 110181698 |
| Molecular Formula | C22H29NOS |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-[[(Z)-3-cyclohexyl-3-thiophen-3-ylprop-2-enyl]amino]-1-phenylpropan-1-ol |
| SMILES | CC(NC/C=C(\c1ccsc1)C1CCCCC1)C(O)c1ccccc1 |
| InChI | InChI=1S/C22H29NOS/c1-17(22(24)19-10-6-3-7-11-19)23-14-12-21(20-13-15-25-16-20)18-8-4-2-5-9-18/h3,6-7,10-13,15-18,22-24H,2,4-5,8-9,14H2,1H3/b21-12- |
| InChIKey | PVESLOXEXFAEGG-MTJSOVHGSA-N |
| XLogP | 5.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |