C21H23NO2S2 — CID 12864504
4-[2-[4,4-di(thiophen-3-yl)but-3-enylamino]-1-hydroxypropyl]phenol (PubChem CID 12864504) has the molecular formula C21H23NO2S2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-[2-[4,4-di(thiophen-3-yl)but-3-enylamino]-1-hydroxypropyl]phenol.
| Compound Name | 4-[2-[4,4-di(thiophen-3-yl)but-3-enylamino]-1-hydroxypropyl]phenol |
|---|---|
| PubChem CID | 12864504 |
| Molecular Formula | C21H23NO2S2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-[2-[4,4-di(thiophen-3-yl)but-3-enylamino]-1-hydroxypropyl]phenol |
| SMILES | CC(NCCC=C(c1ccsc1)c1ccsc1)C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H23NO2S2/c1-15(21(24)16-4-6-19(23)7-5-16)22-10-2-3-20(17-8-11-25-13-17)18-9-12-26-14-18/h3-9,11-15,21-24H,2,10H2,1H3 |
| InChIKey | LPFCDCVCIQYBHB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|